ChemNet > CAS > 342002-82-8 4-Isopropoxycarbonylphenylboronic acid
342002-82-8 4-Isopropoxycarbonylphenylboronic acid
Ονομασία του προϊόντος |
4-Isopropoxycarbonylphenylboronic acid |
Συνώνυμα |
{4-[(1-methylethoxy)carbonyl]phenyl}boronic acid |
MF |
C10H13BO4 |
Μοριακό βάρος |
208.0188 |
InChI |
InChI=1/C10H13BO4/c1-7(2)15-10(12)8-3-5-9(6-4-8)11(13)14/h3-7,13-14H,1-2H3 |
CAS ΟΧΙ |
342002-82-8 |
Μοριακή δομή |
|
Πυκνότητα |
1.17g/cm3 |
Σημείο τήξης |
111℃ |
Σημείο βρασμού |
359°C at 760 mmHg |
Δείκτης διάθλασης |
1.519 |
Σημείο ανάφλεξης |
170.9°C |
Σύμβολα επικινδυνότητας |
Xi:Irritant;
|
Κινδύνου Κώδικες |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Περιγραφή της ασφάλειας |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|